C13H19N3O — CID 68889684
3-(3,5-dimethylphenyl)-5-ethyl-5-methyl-1,2,4-oxadiazol-4-amine (PubChem CID 68889684) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-5-ethyl-5-methyl-1,2,4-oxadiazol-4-amine.
| Compound Name | 3-(3,5-dimethylphenyl)-5-ethyl-5-methyl-1,2,4-oxadiazol-4-amine |
|---|---|
| PubChem CID | 68889684 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-5-ethyl-5-methyl-1,2,4-oxadiazol-4-amine |
| SMILES | CCC1(C)ON=C(c2cc(C)cc(C)c2)N1N |
| InChI | InChI=1S/C13H19N3O/c1-5-13(4)16(14)12(15-17-13)11-7-9(2)6-10(3)8-11/h6-8H,5,14H2,1-4H3 |
| InChIKey | SQJGLHHVRWIZIF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|