C10H15F3N4O2 — CID 68889748
4-amino-5-ethyl-N-[1-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 68889748) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 4-amino-5-ethyl-N-[1-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-N-[1-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 68889748 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-amino-5-ethyl-N-[1-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NC(C)OCC(F)(F)F)c1N |
| InChI | InChI=1S/C10H15F3N4O2/c1-3-6-7(14)8(17-16-6)9(18)15-5(2)19-4-10(11,12)13/h5H,3-4,14H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | FYWNEMNWFIRDFL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|