C14H13IN6 — CID 68889842
1-(3-iodo-2-pyridinyl)-3-N-(2-methylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 68889842) has the molecular formula C14H13IN6 and a molecular weight of 392.20 g/mol. Its IUPAC name is 1-(3-iodo-2-pyridinyl)-3-N-(2-methylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3-iodo-2-pyridinyl)-3-N-(2-methylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 68889842 |
| Molecular Formula | C14H13IN6 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1-(3-iodo-2-pyridinyl)-3-N-(2-methylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1ccccc1Nc1nc(N)n(-c2ncccc2I)n1 |
| InChI | InChI=1S/C14H13IN6/c1-9-5-2-3-7-11(9)18-14-19-13(16)21(20-14)12-10(15)6-4-8-17-12/h2-8H,1H3,(H3,16,18,19,20) |
| InChIKey | BIIICLJJQNQQIP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|