C34H47N5O2 — CID 68889938
N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]benzamide (PubChem CID 68889938) has the molecular formula C34H47N5O2 and a molecular weight of 557.78 g/mol. Its IUPAC name is N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]benzamide.
| Compound Name | N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 68889938 |
| Molecular Formula | C34H47N5O2 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.37 |
| IUPAC Name | N-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]benzamide |
| SMILES | COc1ccc2c(c1)CCC(NC(=O)c1ccc(N/C(=N/[C@H]3C[C@@H]4C[C@@H]([C@H]3C)C4(C)C)N3CCN[C@@H](C)C3)cc1)C2 |
| InChI | InChI=1S/C34H47N5O2/c1-21-20-39(15-14-35-21)33(38-31-19-26-18-30(22(31)2)34(26,3)4)37-27-10-6-23(7-11-27)32(40)36-28-12-8-25-17-29(41-5)13-9-24(25)16-28/h6-7,9-11,13,17,21-22,26,28,30-31,35H,8,12,14-16,18-20H2,1-5H3,(H,36,40)(H,37,38)/t21-,22+,26-,28?,30-,31-/m0/s1 |
| InChIKey | PDILJUKIGNKNGZ-FOMFDVPHSA-N |
| XLogP | 5.11 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|