C21H18N6O6S — CID 68890489
(1R,2S)-9-(1-methylimidazol-4-yl)sulfonyl-4-(4-nitronaphthalen-1-yl)-4,6,9-triazatricyclo[6.1.1.02,6]decane-3,5-dione (PubChem CID 68890489) has the molecular formula C21H18N6O6S and a molecular weight of 482.48 g/mol. Its IUPAC name is (1R,2S)-9-(1-methylimidazol-4-yl)sulfonyl-4-(4-nitronaphthalen-1-yl)-4,6,9-triazatricyclo[6.1.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S)-9-(1-methylimidazol-4-yl)sulfonyl-4-(4-nitronaphthalen-1-yl)-4,6,9-triazatricyclo[6.1.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68890489 |
| Molecular Formula | C21H18N6O6S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | (1R,2S)-9-(1-methylimidazol-4-yl)sulfonyl-4-(4-nitronaphthalen-1-yl)-4,6,9-triazatricyclo[6.1.1.02,6]decane-3,5-dione |
| SMILES | Cn1cnc(S(=O)(=O)N2C3C[C@@H]2[C@H]2C(=O)N(c4ccc([N+](=O)[O-])c5ccccc45)C(=O)N2C3)c1 |
| InChI | InChI=1S/C21H18N6O6S/c1-23-10-18(22-11-23)34(32,33)26-12-8-17(26)19-20(28)25(21(29)24(19)9-12)15-6-7-16(27(30)31)14-5-3-2-4-13(14)15/h2-7,10-12,17,19H,8-9H2,1H3/t12?,17-,19+/m1/s1 |
| InChIKey | BAORKAKKIPIUJP-MKFRLIFGSA-N |
| XLogP | 1.46 |
| TPSA | 138.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|