C21H25N7S2 — CID 68891024
4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione;3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine (PubChem CID 68891024) has the molecular formula C21H25N7S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione;3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine.
| Compound Name | 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione;3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 68891024 |
| Molecular Formula | C21H25N7S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione;3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine |
| SMILES | Cn1c(-c2ccccc2)n[nH]c1=S.Cn1c(SCCCN)nnc1-c1ccccc1 |
| InChI | InChI=1S/C12H16N4S.C9H9N3S/c1-16-11(10-6-3-2-4-7-10)14-15-12(16)17-9-5-8-13;1-12-8(10-11-9(12)13)7-5-3-2-4-6-7/h2-4,6-7H,5,8-9,13H2,1H3;2-6H,1H3,(H,11,13) |
| InChIKey | SKGJSXKDSAKQMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|