About 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine
2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine (PubChem CID 68891452) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine |
| PubChem CID | 68891452 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine |
| SMILES | CCCC(C)c1nc2nccnc2[nH]1 |
| InChI | InChI=1S/C10H14N4/c1-3-4-7(2)8-13-9-10(14-8)12-6-5-11-9/h5-7H,3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | UZEGIEZREVVFAT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine?
The IUPAC name of 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine (CID 68891452) is 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine.
What is the SMILES notation for 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine?
The canonical SMILES for 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine is CCCC(C)c1nc2nccnc2[nH]1.
What is the InChIKey of 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine?
The InChIKey is UZEGIEZREVVFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-3-4-7(2)8-13-9-10(14-8)12-6-5-11-9/h5-7H,3-4H2,1-2H3,(H,11,12,13,14).
What are the key properties of 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine?
2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine has a molecular weight of 190.25 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-2-yl-1H-imidazo[4,5-b]pyrazine is sourced from PubChem (CID 68891452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).