C28H38ClN5O — CID 68891505
3-(4-chlorophenyl)-3-[4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]phenyl]propanamide (PubChem CID 68891505) has the molecular formula C28H38ClN5O and a molecular weight of 496.10 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]phenyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-3-[4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 68891505 |
| Molecular Formula | C28H38ClN5O |
| Molecular Weight | 496.10 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]phenyl]propanamide |
| SMILES | CC1CN(/C(=N\C2CCCCC2)Nc2ccc(C(CC(N)=O)c3ccc(Cl)cc3)cc2)CC(C)N1 |
| InChI | InChI=1S/C28H38ClN5O/c1-19-17-34(18-20(2)31-19)28(32-24-6-4-3-5-7-24)33-25-14-10-22(11-15-25)26(16-27(30)35)21-8-12-23(29)13-9-21/h8-15,19-20,24,26,31H,3-7,16-18H2,1-2H3,(H2,30,35)(H,32,33) |
| InChIKey | WBLKZAQGGREFRH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.10 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|