C24H20ClN5O3 — CID 68891788
(13S)-6-(4-chloro-3-hydroxyphenyl)-15-methyl-5-pyridin-4-yl-3,4,8,15-tetrazatetracyclo[10.2.1.02,10.03,7]pentadeca-2(10),4,6,8-tetraene-13-carboxylic acid (PubChem CID 68891788) has the molecular formula C24H20ClN5O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is (13S)-6-(4-chloro-3-hydroxyphenyl)-15-methyl-5-pyridin-4-yl-3,4,8,15-tetrazatetracyclo[10.2.1.02,10.03,7]pentadeca-2(10),4,6,8-tetraene-13-carboxylic acid.
| Compound Name | (13S)-6-(4-chloro-3-hydroxyphenyl)-15-methyl-5-pyridin-4-yl-3,4,8,15-tetrazatetracyclo[10.2.1.02,10.03,7]pentadeca-2(10),4,6,8-tetraene-13-carboxylic acid |
|---|---|
| PubChem CID | 68891788 |
| Molecular Formula | C24H20ClN5O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (13S)-6-(4-chloro-3-hydroxyphenyl)-15-methyl-5-pyridin-4-yl-3,4,8,15-tetrazatetracyclo[10.2.1.02,10.03,7]pentadeca-2(10),4,6,8-tetraene-13-carboxylic acid |
| SMILES | CN1C2C[C@H](C(=O)O)C1Cc1cnc3c(-c4ccc(Cl)c(O)c4)c(-c4ccncc4)nn3c12 |
| InChI | InChI=1S/C24H20ClN5O3/c1-29-17-8-14-11-27-23-20(13-2-3-16(25)19(31)9-13)21(12-4-6-26-7-5-12)28-30(23)22(14)18(29)10-15(17)24(32)33/h2-7,9,11,15,17-18,31H,8,10H2,1H3,(H,32,33)/t15-,17?,18?/m0/s1 |
| InChIKey | ULCXCOLKELNTOE-ZLPCBKJTSA-N |
| XLogP | 3.82 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |