About 3,8-dihydropurine-2,6-dione
3,8-dihydropurine-2,6-dione (PubChem CID 68891898) has the molecular formula C5H4N4O2
and a molecular weight of 152.11 g/mol. Its IUPAC name is 3,8-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 3,8-dihydropurine-2,6-dione |
| PubChem CID | 68891898 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 3,8-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2c([nH]1)=NCN=2 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H2,(H2,7,8,9,10,11) |
| InChIKey | CFIODUDBMFKTQQ-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dihydropurine-2,6-dione?
The IUPAC name of 3,8-dihydropurine-2,6-dione (CID 68891898) is 3,8-dihydropurine-2,6-dione.
What is the SMILES notation for 3,8-dihydropurine-2,6-dione?
The canonical SMILES for 3,8-dihydropurine-2,6-dione is O=c1[nH]c(=O)c2c([nH]1)=NCN=2.
What is the InChIKey of 3,8-dihydropurine-2,6-dione?
The InChIKey is CFIODUDBMFKTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H2,(H2,7,8,9,10,11).
What are the key properties of 3,8-dihydropurine-2,6-dione?
3,8-dihydropurine-2,6-dione has a molecular weight of 152.11 g/mol, XLogP of -2.73, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dihydropurine-2,6-dione is sourced from PubChem (CID 68891898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).