C29H39Cl2N5O — CID 68891912
3-[4-[[N-cyclohexyl-C-[(3S)-3-propylpiperazin-1-yl]carbonimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide (PubChem CID 68891912) has the molecular formula C29H39Cl2N5O and a molecular weight of 544.57 g/mol. Its IUPAC name is 3-[4-[[N-cyclohexyl-C-[(3S)-3-propylpiperazin-1-yl]carbonimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | 3-[4-[[N-cyclohexyl-C-[(3S)-3-propylpiperazin-1-yl]carbonimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 68891912 |
| Molecular Formula | C29H39Cl2N5O |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 3-[4-[[N-cyclohexyl-C-[(3S)-3-propylpiperazin-1-yl]carbonimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide |
| SMILES | CCC[C@H]1CN(/C(=N\C2CCCCC2)Nc2ccc(C(CC(N)=O)c3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C29H39Cl2N5O/c1-2-6-24-19-36(16-15-33-24)29(34-22-7-4-3-5-8-22)35-23-12-9-20(10-13-23)26(18-28(32)37)25-14-11-21(30)17-27(25)31/h9-14,17,22,24,26,33H,2-8,15-16,18-19H2,1H3,(H2,32,37)(H,34,35)/t24-,26?/m0/s1 |
| InChIKey | RNYYSRQKFCFADN-QSAPEBAKSA-N |
| XLogP | 6.18 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|