C21H22N2O3 — CID 68892025
methyl 6-methoxy-3-(2-methylphenyl)-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 68892025) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 6-methoxy-3-(2-methylphenyl)-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 6-methoxy-3-(2-methylphenyl)-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 68892025 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl 6-methoxy-3-(2-methylphenyl)-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2C)Cc2c([nH]c3ccc(OC)cc23)CN1 |
| InChI | InChI=1S/C21H22N2O3/c1-13-6-4-5-7-17(13)21(20(24)26-3)11-16-15-10-14(25-2)8-9-18(15)23-19(16)12-22-21/h4-10,22-23H,11-12H2,1-3H3 |
| InChIKey | OJJXLCAWRNPQAA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|