C20H26N4OS — CID 6889204
1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 6889204) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 6889204 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[(E)-[4-(diethylamino)phenyl]methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=S)NCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H26N4OS/c1-4-24(5-2)18-10-6-17(7-11-18)15-22-23-20(26)21-14-16-8-12-19(25-3)13-9-16/h6-13,15H,4-5,14H2,1-3H3,(H2,21,23,26)/b22-15+ |
| InChIKey | LNWZCAHWHXGGAY-PXLXIMEGSA-N |
| XLogP | 3.54 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|