About naphthalene;2H-triazole
naphthalene;2H-triazole (PubChem CID 68892159) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is naphthalene;2H-triazole.
Molecular Properties
| Compound Name | naphthalene;2H-triazole |
| PubChem CID | 68892159 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | naphthalene;2H-triazole |
| SMILES | c1ccc2ccccc2c1.c1cn[nH]n1 |
| InChI | InChI=1S/C10H8.C2H3N3/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-4-5-3-1/h1-8H;1-2H,(H,3,4,5) |
| InChIKey | KXSDZNUZMPLBOT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalene;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;2H-triazole?
The IUPAC name of naphthalene;2H-triazole (CID 68892159) is naphthalene;2H-triazole.
What is the SMILES notation for naphthalene;2H-triazole?
The canonical SMILES for naphthalene;2H-triazole is c1ccc2ccccc2c1.c1cn[nH]n1.
What is the InChIKey of naphthalene;2H-triazole?
The InChIKey is KXSDZNUZMPLBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C2H3N3/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-4-5-3-1/h1-8H;1-2H,(H,3,4,5).
What are the key properties of naphthalene;2H-triazole?
naphthalene;2H-triazole has a molecular weight of 197.24 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;2H-triazole is sourced from PubChem (CID 68892159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).