About 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole
5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole (PubChem CID 68892365) has the molecular formula C9H7N5S
and a molecular weight of 217.26 g/mol. Its IUPAC name is 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole |
| PubChem CID | 68892365 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1-c1nc2nccnc2[nH]1 |
| InChI | InChI=1S/C9H7N5S/c1-5-6(15-4-12-5)7-13-8-9(14-7)11-3-2-10-8/h2-4H,1H3,(H,10,11,13,14) |
| InChIKey | WPNRGWVJAZVANR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole?
The IUPAC name of 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole (CID 68892365) is 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole?
The canonical SMILES for 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole is Cc1ncsc1-c1nc2nccnc2[nH]1.
What is the InChIKey of 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole?
The InChIKey is WPNRGWVJAZVANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5S/c1-5-6(15-4-12-5)7-13-8-9(14-7)11-3-2-10-8/h2-4H,1H3,(H,10,11,13,14).
What are the key properties of 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole?
5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole has a molecular weight of 217.26 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-imidazo[4,5-b]pyrazin-2-yl)-4-methyl-1,3-thiazole is sourced from PubChem (CID 68892365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).