About (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid
(5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid (PubChem CID 68892698) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid.
Molecular Properties
| Compound Name | (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid |
| PubChem CID | 68892698 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid |
| SMILES | Cc1cccc2c1C(=O)NC(CNC(=O)O)N2 |
| InChI | InChI=1S/C11H13N3O3/c1-6-3-2-4-7-9(6)10(15)14-8(13-7)5-12-11(16)17/h2-4,8,12-13H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | YIDLDPMXJCFZSC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid?
The IUPAC name of (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid (CID 68892698) is (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid.
What is the SMILES notation for (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid?
The canonical SMILES for (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid is Cc1cccc2c1C(=O)NC(CNC(=O)O)N2.
What is the InChIKey of (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid?
The InChIKey is YIDLDPMXJCFZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-6-3-2-4-7-9(6)10(15)14-8(13-7)5-12-11(16)17/h2-4,8,12-13H,5H2,1H3,(H,14,15)(H,16,17).
What are the key properties of (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid?
(5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid has a molecular weight of 235.24 g/mol, XLogP of 0.74, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)methylcarbamic acid is sourced from PubChem (CID 68892698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).