About [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate
[5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate (PubChem CID 68893003) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate.
Molecular Properties
| Compound Name | [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate |
| PubChem CID | 68893003 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate |
| SMILES | NC(=O)OCCCCC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H14N2O4/c14-13(17)18-8-4-3-6-10(16)12-15-9-5-1-2-7-11(9)19-12/h1-2,5,7H,3-4,6,8H2,(H2,14,17) |
| InChIKey | CUIWFPZIUKVILA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate?
The IUPAC name of [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate (CID 68893003) is [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate.
What is the SMILES notation for [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate?
The canonical SMILES for [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate is NC(=O)OCCCCC(=O)c1nc2ccccc2o1.
What is the InChIKey of [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate?
The InChIKey is CUIWFPZIUKVILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c14-13(17)18-8-4-3-6-10(16)12-15-9-5-1-2-7-11(9)19-12/h1-2,5,7H,3-4,6,8H2,(H2,14,17).
What are the key properties of [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate?
[5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate has a molecular weight of 262.26 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-benzoxazol-2-yl)-5-oxopentyl] carbamate is sourced from PubChem (CID 68893003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).