C22H29N5O4 — CID 68893087
3-[[(2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 68893087) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-[[(2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68893087 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 3-[[(2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(CCCCC#N)c2ccccc12)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C22H29N5O4/c1-22(2,3)19(21(31)24-13-11-17(28)29)25-20(30)18-15-9-5-6-10-16(15)27(26-18)14-8-4-7-12-23/h5-6,9-10,19H,4,7-8,11,13-14H2,1-3H3,(H,24,31)(H,25,30)(H,28,29)/t19-/m1/s1 |
| InChIKey | AQJWMKUEMRMMLF-LJQANCHMSA-N |
| XLogP | 2.47 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|