About 1,2-dihydroimidazo[4,5-e]quinolin-4-amine
1,2-dihydroimidazo[4,5-e]quinolin-4-amine (PubChem CID 68893241) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 1,2-dihydroimidazo[4,5-e]quinolin-4-amine.
Molecular Properties
| Compound Name | 1,2-dihydroimidazo[4,5-e]quinolin-4-amine |
| PubChem CID | 68893241 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,2-dihydroimidazo[4,5-e]quinolin-4-amine |
| SMILES | NC1=CC=C2N=CC=CC23NCN=C13 |
| InChI | InChI=1S/C10H10N4/c11-7-2-3-8-10(4-1-5-12-8)9(7)13-6-14-10/h1-5,14H,6,11H2 |
| InChIKey | FEVRYGZDIYQNDI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dihydroimidazo[4,5-e]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroimidazo[4,5-e]quinolin-4-amine?
The IUPAC name of 1,2-dihydroimidazo[4,5-e]quinolin-4-amine (CID 68893241) is 1,2-dihydroimidazo[4,5-e]quinolin-4-amine.
What is the SMILES notation for 1,2-dihydroimidazo[4,5-e]quinolin-4-amine?
The canonical SMILES for 1,2-dihydroimidazo[4,5-e]quinolin-4-amine is NC1=CC=C2N=CC=CC23NCN=C13.
What is the InChIKey of 1,2-dihydroimidazo[4,5-e]quinolin-4-amine?
The InChIKey is FEVRYGZDIYQNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-7-2-3-8-10(4-1-5-12-8)9(7)13-6-14-10/h1-5,14H,6,11H2.
What are the key properties of 1,2-dihydroimidazo[4,5-e]quinolin-4-amine?
1,2-dihydroimidazo[4,5-e]quinolin-4-amine has a molecular weight of 186.22 g/mol, XLogP of 0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroimidazo[4,5-e]quinolin-4-amine is sourced from PubChem (CID 68893241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).