C14H22N4O2 — CID 68893430
(3S,3aR,6S,6aR)-6-[4-(cyclopentylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 68893430) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-6-[4-(cyclopentylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | (3S,3aR,6S,6aR)-6-[4-(cyclopentylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 68893430 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3S,3aR,6S,6aR)-6-[4-(cyclopentylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1cc(CC2CCCC2)nn1 |
| InChI | InChI=1S/C14H22N4O2/c15-11-7-19-14-12(8-20-13(11)14)18-6-10(16-17-18)5-9-3-1-2-4-9/h6,9,11-14H,1-5,7-8,15H2/t11-,12-,13+,14+/m0/s1 |
| InChIKey | BOKPAVOPPPZNGF-IGQOVBAYSA-N |
| XLogP | 0.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |