C18H35OP — CID 68894147
(3,3-dicyclohexyl-2-methylpentan-2-yl)oxyphosphane (PubChem CID 68894147) has the molecular formula C18H35OP and a molecular weight of 298.45 g/mol. Its IUPAC name is (3,3-dicyclohexyl-2-methylpentan-2-yl)oxyphosphane.
| Compound Name | (3,3-dicyclohexyl-2-methylpentan-2-yl)oxyphosphane |
|---|---|
| PubChem CID | 68894147 |
| Molecular Formula | C18H35OP |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (3,3-dicyclohexyl-2-methylpentan-2-yl)oxyphosphane |
| SMILES | CCC(C1CCCCC1)(C1CCCCC1)C(C)(C)OP |
| InChI | InChI=1S/C18H35OP/c1-4-18(17(2,3)19-20,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h15-16H,4-14,20H2,1-3H3 |
| InChIKey | PRSRNOQDKDVNNU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|