About tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid
tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid (PubChem CID 68894786) has the molecular formula C20H20N2O2S
and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid |
| PubChem CID | 68894786 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1nc(-c2ccccc2)sc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-20(2,3)22(19(23)24)17-16(14-10-6-4-7-11-14)25-18(21-17)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,23,24) |
| InChIKey | MMEZWTYZIHLGNL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid?
The IUPAC name of tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid (CID 68894786) is tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid.
What is the SMILES notation for tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid?
The canonical SMILES for tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid is CC(C)(C)N(C(=O)O)c1nc(-c2ccccc2)sc1-c1ccccc1.
What is the InChIKey of tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid?
The InChIKey is MMEZWTYZIHLGNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2S/c1-20(2,3)22(19(23)24)17-16(14-10-6-4-7-11-14)25-18(21-17)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,23,24).
What are the key properties of tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid?
tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid has a molecular weight of 352.46 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(2,5-diphenyl-1,3-thiazol-4-yl)carbamic acid is sourced from PubChem (CID 68894786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).