About benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide
benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide (PubChem CID 68895013) has the molecular formula C17H26N4O3S
and a molecular weight of 366.49 g/mol. Its IUPAC name is benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide.
Molecular Properties
| Compound Name | benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide |
| PubChem CID | 68895013 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide |
| SMILES | CC(NS(C)(=O)=O)C(=O)Nc1cc(C(C)(C)C)[nH]n1.c1ccccc1 |
| InChI | InChI=1S/C11H20N4O3S.C6H6/c1-7(15-19(5,17)18)10(16)12-9-6-8(13-14-9)11(2,3)4;1-2-4-6-5-3-1/h6-7,15H,1-5H3,(H2,12,13,14,16);1-6H |
| InChIKey | HQWSTWQYOJEZOG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide?
The IUPAC name of benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide (CID 68895013) is benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide.
What is the SMILES notation for benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide?
The canonical SMILES for benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide is CC(NS(C)(=O)=O)C(=O)Nc1cc(C(C)(C)C)[nH]n1.c1ccccc1.
What is the InChIKey of benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide?
The InChIKey is HQWSTWQYOJEZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3S.C6H6/c1-7(15-19(5,17)18)10(16)12-9-6-8(13-14-9)11(2,3)4;1-2-4-6-5-3-1/h6-7,15H,1-5H3,(H2,12,13,14,16);1-6H.
What are the key properties of benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide?
benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide has a molecular weight of 366.49 g/mol, XLogP of 2.27, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(5-tert-butyl-1H-pyrazol-3-yl)-2-(methanesulfonamido)propanamide is sourced from PubChem (CID 68895013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).