About 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid
2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid (PubChem CID 68895283) has the molecular formula C23H20Cl2N2O4
and a molecular weight of 459.33 g/mol. Its IUPAC name is 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid |
| PubChem CID | 68895283 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCCCOc3cccc4[nH]cc(CC(=O)O)c34)c2n1 |
| InChI | InChI=1S/C23H20Cl2N2O4/c1-13-6-7-15-16(24)11-17(25)23(22(15)27-13)31-9-3-8-30-19-5-2-4-18-21(19)14(12-26-18)10-20(28)29/h2,4-7,11-12,26H,3,8-10H2,1H3,(H,28,29) |
| InChIKey | SFPNAAWXABNFGF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid?
The IUPAC name of 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid (CID 68895283) is 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid?
The canonical SMILES for 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid is Cc1ccc2c(Cl)cc(Cl)c(OCCCOc3cccc4[nH]cc(CC(=O)O)c34)c2n1.
What is the InChIKey of 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid?
The InChIKey is SFPNAAWXABNFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2N2O4/c1-13-6-7-15-16(24)11-17(25)23(22(15)27-13)31-9-3-8-30-19-5-2-4-18-21(19)14(12-26-18)10-20(28)29/h2,4-7,11-12,26H,3,8-10H2,1H3,(H,28,29).
What are the key properties of 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid?
2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid has a molecular weight of 459.33 g/mol, XLogP of 5.81, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(5,7-dichloro-2-methylquinolin-8-yl)oxypropoxy]-1H-indol-3-yl]acetic acid is sourced from PubChem (CID 68895283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).