C21H24N2O3S — CID 68895479
(3R)-3-piperidin-4-ylspiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 68895479) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is (3R)-3-piperidin-4-ylspiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | (3R)-3-piperidin-4-ylspiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 68895479 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3R)-3-piperidin-4-ylspiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1S[C@H](C1CCNCC1)C1(CCNCC1)O2 |
| InChI | InChI=1S/C21H24N2O3S/c24-16-14-3-1-2-4-15(14)18-19(17(16)25)27-20(13-5-9-22-10-6-13)21(26-18)7-11-23-12-8-21/h1-4,13,20,22-23H,5-12H2/t20-/m1/s1 |
| InChIKey | UOKYKSJMUCYRFY-HXUWFJFHSA-N |
| XLogP | 2.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|