C28H34N6O6S — CID 68895550
4-[(1,1-dihydroxy-2,3-dihydro-1λ4,4-benzothiazin-4-yl)methyl]-N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzamide (PubChem CID 68895550) has the molecular formula C28H34N6O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is 4-[(1,1-dihydroxy-2,3-dihydro-1λ4,4-benzothiazin-4-yl)methyl]-N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzamide.
| Compound Name | 4-[(1,1-dihydroxy-2,3-dihydro-1λ4,4-benzothiazin-4-yl)methyl]-N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzamide |
|---|---|
| PubChem CID | 68895550 |
| Molecular Formula | C28H34N6O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 4-[(1,1-dihydroxy-2,3-dihydro-1λ4,4-benzothiazin-4-yl)methyl]-N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzamide |
| SMILES | O=C1NC(=O)C2(CN(C(=O)C3CCNCC3)CC2NC(=O)c2ccc(CN3CCS(O)(O)c4ccccc43)cc2)N1 |
| InChI | InChI=1S/C28H34N6O6S/c35-24(19-7-5-18(6-8-19)15-33-13-14-41(39,40)22-4-2-1-3-21(22)33)30-23-16-34(25(36)20-9-11-29-12-10-20)17-28(23)26(37)31-27(38)32-28/h1-8,20,23,29,39-40H,9-17H2,(H,30,35)(H2,31,32,37,38) |
| InChIKey | BTNLQCOGVBXUNX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|