About 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid
2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid (PubChem CID 68895680) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid.
Molecular Properties
| Compound Name | 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid |
| PubChem CID | 68895680 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid |
| SMILES | O=C(O)CN1CCC2(CCc3ccccc32)CC1 |
| InChI | InChI=1S/C15H19NO2/c17-14(18)11-16-9-7-15(8-10-16)6-5-12-3-1-2-4-13(12)15/h1-4H,5-11H2,(H,17,18) |
| InChIKey | VEBFJSBWIPTGGH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid?
The IUPAC name of 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid (CID 68895680) is 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid.
What is the SMILES notation for 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid?
The canonical SMILES for 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid is O=C(O)CN1CCC2(CCc3ccccc32)CC1.
What is the InChIKey of 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid?
The InChIKey is VEBFJSBWIPTGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c17-14(18)11-16-9-7-15(8-10-16)6-5-12-3-1-2-4-13(12)15/h1-4H,5-11H2,(H,17,18).
What are the key properties of 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid?
2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid has a molecular weight of 245.32 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylacetic acid is sourced from PubChem (CID 68895680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).