C20H27N3O2 — CID 68895820
2,4-dimethyl-6-[4-(3-piperidin-3-ylpropoxy)phenyl]pyridazin-3-one (PubChem CID 68895820) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2,4-dimethyl-6-[4-(3-piperidin-3-ylpropoxy)phenyl]pyridazin-3-one.
| Compound Name | 2,4-dimethyl-6-[4-(3-piperidin-3-ylpropoxy)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 68895820 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2,4-dimethyl-6-[4-(3-piperidin-3-ylpropoxy)phenyl]pyridazin-3-one |
| SMILES | Cc1cc(-c2ccc(OCCCC3CCCNC3)cc2)nn(C)c1=O |
| InChI | InChI=1S/C20H27N3O2/c1-15-13-19(22-23(2)20(15)24)17-7-9-18(10-8-17)25-12-4-6-16-5-3-11-21-14-16/h7-10,13,16,21H,3-6,11-12,14H2,1-2H3 |
| InChIKey | OPNJXBGPRXAQIM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|