About 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol
6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol (PubChem CID 68895906) has the molecular formula C14H13FN4O2S
and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol.
Molecular Properties
| Compound Name | 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol |
| PubChem CID | 68895906 |
| Molecular Formula | C14H13FN4O2S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol |
| SMILES | CCOc1cc(F)ccc1-c1sc2c(NN)ncnc2c1O |
| InChI | InChI=1S/C14H13FN4O2S/c1-2-21-9-5-7(15)3-4-8(9)12-11(20)10-13(22-12)14(19-16)18-6-17-10/h3-6,20H,2,16H2,1H3,(H,17,18,19) |
| InChIKey | JNGYZRVRLNVOSH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol?
The IUPAC name of 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol (CID 68895906) is 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol.
What is the SMILES notation for 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol?
The canonical SMILES for 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol is CCOc1cc(F)ccc1-c1sc2c(NN)ncnc2c1O.
What is the InChIKey of 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol?
The InChIKey is JNGYZRVRLNVOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4O2S/c1-2-21-9-5-7(15)3-4-8(9)12-11(20)10-13(22-12)14(19-16)18-6-17-10/h3-6,20H,2,16H2,1H3,(H,17,18,19).
What are the key properties of 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol?
6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol has a molecular weight of 320.35 g/mol, XLogP of 2.89, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-ethoxy-4-fluorophenyl)-4-hydrazinylthieno[3,2-d]pyrimidin-7-ol is sourced from PubChem (CID 68895906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).