C17H20ClF2N3O2S — CID 68896726
3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine;hydrochloride (PubChem CID 68896726) has the molecular formula C17H20ClF2N3O2S and a molecular weight of 403.88 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine;hydrochloride.
| Compound Name | 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 68896726 |
| Molecular Formula | C17H20ClF2N3O2S |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-ethylpropan-1-amine;hydrochloride |
| SMILES | CCNCCCN1c2ccccc2N(c2ccc(F)cc2F)S1(=O)=O.Cl |
| InChI | InChI=1S/C17H19F2N3O2S.ClH/c1-2-20-10-5-11-21-16-6-3-4-7-17(16)22(25(21,23)24)15-9-8-13(18)12-14(15)19;/h3-4,6-9,12,20H,2,5,10-11H2,1H3;1H |
| InChIKey | NTBQJUONSMTKDG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|