About 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol
1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 68896861) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol |
| PubChem CID | 68896861 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | C=CCC1(C(C)O)C=CC=CC1 |
| InChI | InChI=1S/C11H16O/c1-3-7-11(10(2)12)8-5-4-6-9-11/h3-6,8,10,12H,1,7,9H2,2H3 |
| InChIKey | GBLOFCUCAHHHNB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol?
The IUPAC name of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol (CID 68896861) is 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol.
What is the SMILES notation for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol?
The canonical SMILES for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol is C=CCC1(C(C)O)C=CC=CC1.
What is the InChIKey of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol?
The InChIKey is GBLOFCUCAHHHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-3-7-11(10(2)12)8-5-4-6-9-11/h3-6,8,10,12H,1,7,9H2,2H3.
What are the key properties of 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol?
1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol has a molecular weight of 164.25 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-prop-2-enylcyclohexa-2,4-dien-1-yl)ethanol is sourced from PubChem (CID 68896861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).