C17H17BrFN3OS — CID 68897086
6-(1-bromo-2-methylpropyl)-5-[(3-fluorophenyl)methyl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-one (PubChem CID 68897086) has the molecular formula C17H17BrFN3OS and a molecular weight of 410.31 g/mol. Its IUPAC name is 6-(1-bromo-2-methylpropyl)-5-[(3-fluorophenyl)methyl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-(1-bromo-2-methylpropyl)-5-[(3-fluorophenyl)methyl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 68897086 |
| Molecular Formula | C17H17BrFN3OS |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 6-(1-bromo-2-methylpropyl)-5-[(3-fluorophenyl)methyl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1nsc2nc(C(Br)C(C)C)n(Cc3cccc(F)c3)c(=O)c12 |
| InChI | InChI=1S/C17H17BrFN3OS/c1-9(2)14(18)15-20-16-13(10(3)21-24-16)17(23)22(15)8-11-5-4-6-12(19)7-11/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | KPOVAIFJAVMIOE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|