About 2-isoquinolin-7-ylphenol
2-isoquinolin-7-ylphenol (PubChem CID 68897209) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-isoquinolin-7-ylphenol.
Molecular Properties
| Compound Name | 2-isoquinolin-7-ylphenol |
| PubChem CID | 68897209 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-isoquinolin-7-ylphenol |
| SMILES | Oc1ccccc1-c1ccc2ccncc2c1 |
| InChI | InChI=1S/C15H11NO/c17-15-4-2-1-3-14(15)12-6-5-11-7-8-16-10-13(11)9-12/h1-10,17H |
| InChIKey | MICVSUXPMLAUHM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-isoquinolin-7-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoquinolin-7-ylphenol?
The IUPAC name of 2-isoquinolin-7-ylphenol (CID 68897209) is 2-isoquinolin-7-ylphenol.
What is the SMILES notation for 2-isoquinolin-7-ylphenol?
The canonical SMILES for 2-isoquinolin-7-ylphenol is Oc1ccccc1-c1ccc2ccncc2c1.
What is the InChIKey of 2-isoquinolin-7-ylphenol?
The InChIKey is MICVSUXPMLAUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c17-15-4-2-1-3-14(15)12-6-5-11-7-8-16-10-13(11)9-12/h1-10,17H.
What are the key properties of 2-isoquinolin-7-ylphenol?
2-isoquinolin-7-ylphenol has a molecular weight of 221.26 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoquinolin-7-ylphenol is sourced from PubChem (CID 68897209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).