C19H21N3O2S — CID 6889742
1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3,5,6-trimethylbenzimidazole-2-thione (PubChem CID 6889742) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3,5,6-trimethylbenzimidazole-2-thione.
| Compound Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3,5,6-trimethylbenzimidazole-2-thione |
|---|---|
| PubChem CID | 6889742 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3,5,6-trimethylbenzimidazole-2-thione |
| SMILES | COc1cccc(/C=N/n2c(=S)n(C)c3cc(C)c(C)cc32)c1OC |
| InChI | InChI=1S/C19H21N3O2S/c1-12-9-15-16(10-13(12)2)22(19(25)21(15)3)20-11-14-7-6-8-17(23-4)18(14)24-5/h6-11H,1-5H3/b20-11+ |
| InChIKey | TWCWIYMRHQSTDM-RGVLZGJSSA-N |
| XLogP | 4.23 |
| TPSA | 40.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|