C16H17BrN2O2S — CID 68897488
1-(3-bromopropyl)-3-(4-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 68897488) has the molecular formula C16H17BrN2O2S and a molecular weight of 381.30 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-(4-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 1-(3-bromopropyl)-3-(4-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 68897488 |
| Molecular Formula | C16H17BrN2O2S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 1-(3-bromopropyl)-3-(4-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | Cc1ccc(N2c3ccccc3N(CCCBr)S2(=O)=O)cc1 |
| InChI | InChI=1S/C16H17BrN2O2S/c1-13-7-9-14(10-8-13)19-16-6-3-2-5-15(16)18(12-4-11-17)22(19,20)21/h2-3,5-10H,4,11-12H2,1H3 |
| InChIKey | DEHQBGPHXIEPNW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|