C10H14O — CID 68897886
1,5,6,7,8,8a-hexahydronaphthalen-2-ol (PubChem CID 68897886) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 1,5,6,7,8,8a-hexahydronaphthalen-2-ol.
| Compound Name | 1,5,6,7,8,8a-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 68897886 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1,5,6,7,8,8a-hexahydronaphthalen-2-ol |
| SMILES | OC1=CC=C2CCCCC2C1 |
| InChI | InChI=1S/C10H14O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h5-6,9,11H,1-4,7H2 |
| InChIKey | CYOIENDJTIPIRO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |