C28H28N6O3 — CID 68898085
carbamic acid;3-cyclohexyl-1-(2-phenoxyquinolin-7-yl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 68898085) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is carbamic acid;3-cyclohexyl-1-(2-phenoxyquinolin-7-yl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | carbamic acid;3-cyclohexyl-1-(2-phenoxyquinolin-7-yl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 68898085 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | carbamic acid;3-cyclohexyl-1-(2-phenoxyquinolin-7-yl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | NC(=O)O.Nc1nccn2c(C3CCCCC3)nc(-c3ccc4ccc(Oc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C27H25N5O.CH3NO2/c28-26-25-24(31-27(32(25)16-15-29-26)19-7-3-1-4-8-19)20-12-11-18-13-14-23(30-22(18)17-20)33-21-9-5-2-6-10-21;2-1(3)4/h2,5-6,9-17,19H,1,3-4,7-8H2,(H2,28,29);2H2,(H,3,4) |
| InChIKey | VNWHRKVNNYDPNW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |