C14H16F3N3O4 — CID 68898176
1-(2-aminoethyl)-2-oxo-3,4-dihydroquinoline-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 68898176) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-(2-aminoethyl)-2-oxo-3,4-dihydroquinoline-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-aminoethyl)-2-oxo-3,4-dihydroquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68898176 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(2-aminoethyl)-2-oxo-3,4-dihydroquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCN1C(=O)C(C(N)=O)Cc2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15N3O2.C2HF3O2/c13-5-6-15-10-4-2-1-3-8(10)7-9(11(14)16)12(15)17;3-2(4,5)1(6)7/h1-4,9H,5-7,13H2,(H2,14,16);(H,6,7) |
| InChIKey | JATBLNWYUWGHBO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|