C12H9ClN2O2S — CID 68898237
3-(3-chlorophenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 68898237) has the molecular formula C12H9ClN2O2S and a molecular weight of 280.74 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 3-(3-chlorophenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 68898237 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-(3-chlorophenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | O=S1(=O)Nc2ccccc2N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H9ClN2O2S/c13-9-4-3-5-10(8-9)15-12-7-2-1-6-11(12)14-18(15,16)17/h1-8,14H |
| InChIKey | ZNIPVSPLKAQPSQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |