About diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid
diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid (PubChem CID 68898292) has the molecular formula C19H24N2O10
and a molecular weight of 440.41 g/mol. Its IUPAC name is diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid.
Molecular Properties
| Compound Name | diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid |
| PubChem CID | 68898292 |
| Molecular Formula | C19H24N2O10 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid |
| SMILES | CCOC(=O)CC(=O)OCC.O=C(O)C(=CNC(C[N+](=O)[O-])c1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H12N2O6.C7H12O4/c15-11(16)9(12(17)18)6-13-10(7-14(19)20)8-4-2-1-3-5-8;1-3-10-6(8)5-7(9)11-4-2/h1-6,10,13H,7H2,(H,15,16)(H,17,18);3-5H2,1-2H3 |
| InChIKey | YMBCFKFZXMQZPC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid?
The IUPAC name of diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid (CID 68898292) is diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid.
What is the SMILES notation for diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid?
The canonical SMILES for diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid is CCOC(=O)CC(=O)OCC.O=C(O)C(=CNC(C[N+](=O)[O-])c1ccccc1)C(=O)O.
What is the InChIKey of diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid?
The InChIKey is YMBCFKFZXMQZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O6.C7H12O4/c15-11(16)9(12(17)18)6-13-10(7-14(19)20)8-4-2-1-3-5-8;1-3-10-6(8)5-7(9)11-4-2/h1-6,10,13H,7H2,(H,15,16)(H,17,18);3-5H2,1-2H3.
What are the key properties of diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid?
diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid has a molecular weight of 440.41 g/mol, XLogP of 1.15, 11 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl propanedioate;2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioic acid is sourced from PubChem (CID 68898292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).