About (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate
(7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate (PubChem CID 68898383) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate |
| PubChem CID | 68898383 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate |
| SMILES | CCCN1CCC2(CC1)CN(OC(=O)O)C2 |
| InChI | InChI=1S/C11H20N2O3/c1-2-5-12-6-3-11(4-7-12)8-13(9-11)16-10(14)15/h2-9H2,1H3,(H,14,15) |
| InChIKey | KFLBHEBBCBVGGI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate?
The IUPAC name of (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate (CID 68898383) is (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate.
What is the SMILES notation for (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate?
The canonical SMILES for (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate is CCCN1CCC2(CC1)CN(OC(=O)O)C2.
What is the InChIKey of (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate?
The InChIKey is KFLBHEBBCBVGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-2-5-12-6-3-11(4-7-12)8-13(9-11)16-10(14)15/h2-9H2,1H3,(H,14,15).
What are the key properties of (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate?
(7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate has a molecular weight of 228.29 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-propyl-2,7-diazaspiro[3.5]nonan-2-yl) hydrogen carbonate is sourced from PubChem (CID 68898383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).