C17H18N4O3 — CID 6889842
N-(4-methoxyphenyl)-N'-[(E)-pyridin-3-ylmethylideneamino]butanediamide (PubChem CID 6889842) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[(E)-pyridin-3-ylmethylideneamino]butanediamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[(E)-pyridin-3-ylmethylideneamino]butanediamide |
|---|---|
| PubChem CID | 6889842 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[(E)-pyridin-3-ylmethylideneamino]butanediamide |
| SMILES | COc1ccc(NC(=O)CCC(=O)N/N=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-24-15-6-4-14(5-7-15)20-16(22)8-9-17(23)21-19-12-13-3-2-10-18-11-13/h2-7,10-12H,8-9H2,1H3,(H,20,22)(H,21,23)/b19-12+ |
| InChIKey | PUUZHZBZOQBXFR-XDHOZWIPSA-N |
| XLogP | 1.96 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|