About 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate
2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate (PubChem CID 68898440) has the molecular formula C23H42O5
and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate.
Molecular Properties
| Compound Name | 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate |
| PubChem CID | 68898440 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate |
| SMILES | C=C(C)C1CCC(C)CC1OC(=O)O.CC(C)C1(C)CCCC(OCCO)C1 |
| InChI | InChI=1S/C12H24O2.C11H18O3/c1-10(2)12(3)6-4-5-11(9-12)14-8-7-13;1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h10-11,13H,4-9H2,1-3H3;8-10H,1,4-6H2,2-3H3,(H,12,13) |
| InChIKey | HMOLQPPVUJMKHI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate?
The IUPAC name of 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate (CID 68898440) is 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate.
What is the SMILES notation for 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate?
The canonical SMILES for 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate is C=C(C)C1CCC(C)CC1OC(=O)O.CC(C)C1(C)CCCC(OCCO)C1.
What is the InChIKey of 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate?
The InChIKey is HMOLQPPVUJMKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C11H18O3/c1-10(2)12(3)6-4-5-11(9-12)14-8-7-13;1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h10-11,13H,4-9H2,1-3H3;8-10H,1,4-6H2,2-3H3,(H,12,13).
What are the key properties of 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate?
2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate has a molecular weight of 398.58 g/mol, XLogP of 5.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-3-propan-2-ylcyclohexyl)oxyethanol;(5-methyl-2-prop-1-en-2-ylcyclohexyl) hydrogen carbonate is sourced from PubChem (CID 68898440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).