C17H22FN3O2S — CID 68898549
3-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine (PubChem CID 68898549) has the molecular formula C17H22FN3O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 68898549 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1c2ccccc2N(c2ccc(C)cc2F)S1(O)O |
| InChI | InChI=1S/C17H22FN3O2S/c1-13-8-9-15(14(18)12-13)21-17-7-4-3-6-16(17)20(24(21,22)23)11-5-10-19-2/h3-4,6-9,12,19,22-23H,5,10-11H2,1-2H3 |
| InChIKey | XNMMJKZEIWDYBW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|