C18H13N5O5 — CID 6889893
7-methoxy-3-[(E)-(3-nitrophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 6889893) has the molecular formula C18H13N5O5 and a molecular weight of 379.33 g/mol. Its IUPAC name is 7-methoxy-3-[(E)-(3-nitrophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 7-methoxy-3-[(E)-(3-nitrophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 6889893 |
| Molecular Formula | C18H13N5O5 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 7-methoxy-3-[(E)-(3-nitrophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(/N=C/c3cccc([N+](=O)[O-])c3)c(=O)[nH]c12 |
| InChI | InChI=1S/C18H13N5O5/c1-28-12-5-6-13-14(8-12)20-16-15(13)21-18(25)22(17(16)24)19-9-10-3-2-4-11(7-10)23(26)27/h2-9,20H,1H3,(H,21,25)/b19-9+ |
| InChIKey | MMKBSYVNTIPKKN-DJKKODMXSA-N |
| XLogP | 1.97 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|