C22H22F2N2O — CID 68898993
[(2R)-4-(2,5-difluorophenyl)-2-methylpyrrolidin-2-yl]-(2-phenyl-2,5-dihydropyrrol-1-yl)methanone (PubChem CID 68898993) has the molecular formula C22H22F2N2O and a molecular weight of 368.43 g/mol. Its IUPAC name is [(2R)-4-(2,5-difluorophenyl)-2-methylpyrrolidin-2-yl]-(2-phenyl-2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [(2R)-4-(2,5-difluorophenyl)-2-methylpyrrolidin-2-yl]-(2-phenyl-2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 68898993 |
| Molecular Formula | C22H22F2N2O |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(2R)-4-(2,5-difluorophenyl)-2-methylpyrrolidin-2-yl]-(2-phenyl-2,5-dihydropyrrol-1-yl)methanone |
| SMILES | C[C@]1(C(=O)N2CC=CC2c2ccccc2)CC(c2cc(F)ccc2F)CN1 |
| InChI | InChI=1S/C22H22F2N2O/c1-22(13-16(14-25-22)18-12-17(23)9-10-19(18)24)21(27)26-11-5-8-20(26)15-6-3-2-4-7-15/h2-10,12,16,20,25H,11,13-14H2,1H3/t16?,20?,22-/m1/s1 |
| InChIKey | UCONASCCVKTOMA-HTRPQEOZSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|