C13H16N2O4S — CID 68899071
(2S,3R,4S,5S)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxythiane-3,4,5-triol (PubChem CID 68899071) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxythiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxythiane-3,4,5-triol |
|---|---|
| PubChem CID | 68899071 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2S,3R,4S,5S)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxythiane-3,4,5-triol |
| SMILES | Cc1cn2cccc(O[C@H]3SC[C@@H](O)[C@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H16N2O4S/c1-7-5-15-4-2-3-9(12(15)14-7)19-13-11(18)10(17)8(16)6-20-13/h2-5,8,10-11,13,16-18H,6H2,1H3/t8-,10+,11-,13+/m1/s1 |
| InChIKey | UGLPGYWPPIGAIM-QTFBWGAVSA-N |
| XLogP | 0.18 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |