C22H24FN5O2 — CID 68899102
[1-[6-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-nitro-2-pyridinyl]cyclopropyl]methanamine (PubChem CID 68899102) has the molecular formula C22H24FN5O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is [1-[6-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-nitro-2-pyridinyl]cyclopropyl]methanamine.
| Compound Name | [1-[6-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-nitro-2-pyridinyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 68899102 |
| Molecular Formula | C22H24FN5O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [1-[6-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-nitro-2-pyridinyl]cyclopropyl]methanamine |
| SMILES | CC(C)(C)c1nc(-c2ccc(F)cc2)c(-c2ccc([N+](=O)[O-])c(C3(CN)CC3)n2)[nH]1 |
| InChI | InChI=1S/C22H24FN5O2/c1-21(2,3)20-26-17(13-4-6-14(23)7-5-13)18(27-20)15-8-9-16(28(29)30)19(25-15)22(12-24)10-11-22/h4-9H,10-12,24H2,1-3H3,(H,26,27) |
| InChIKey | OBINNCYYZVRPST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|