C25H25Cl2N3O4 — CID 68899684
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[3-[4-(pyridin-2-ylamino)butoxy]phenyl]propanoic acid (PubChem CID 68899684) has the molecular formula C25H25Cl2N3O4 and a molecular weight of 502.40 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[3-[4-(pyridin-2-ylamino)butoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[3-[4-(pyridin-2-ylamino)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68899684 |
| Molecular Formula | C25H25Cl2N3O4 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[3-[4-(pyridin-2-ylamino)butoxy]phenyl]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1cccc(OCCCCNc2ccccn2)c1)C(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H25Cl2N3O4/c26-19-9-6-10-20(27)23(19)24(31)30-21(25(32)33)16-17-7-5-8-18(15-17)34-14-4-3-13-29-22-11-1-2-12-28-22/h1-2,5-12,15,21H,3-4,13-14,16H2,(H,28,29)(H,30,31)(H,32,33)/t21-/m0/s1 |
| InChIKey | ZAMWQLRLHFTKPL-NRFANRHFSA-N |
| XLogP | 5.09 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|