C23H14N6O2 — CID 6889988
17-[(E)-furan-2-ylmethylideneamino]-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 6889988) has the molecular formula C23H14N6O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 17-[(E)-furan-2-ylmethylideneamino]-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-[(E)-furan-2-ylmethylideneamino]-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 6889988 |
| Molecular Formula | C23H14N6O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 17-[(E)-furan-2-ylmethylideneamino]-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | O=c1c2c3nc4ccccc4nc3n(/N=C/c3ccco3)c2ncn1-c1ccccc1 |
| InChI | InChI=1S/C23H14N6O2/c30-23-19-20-22(27-18-11-5-4-10-17(18)26-20)29(25-13-16-9-6-12-31-16)21(19)24-14-28(23)15-7-2-1-3-8-15/h1-14H/b25-13+ |
| InChIKey | OTDNUGJEFFJYQV-DHRITJCHSA-N |
| XLogP | 3.76 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|